CAS 475591-59-4 appears in our catalog under these names: Boc-nh-peg2-nh-boc, 95%, Boc–NH–PEG2–NH–Boc, Boc-NH-PEG2-NH-Boc, 97%, 97%, Boc-NH-PEG2-NH-Boc, 97.0%, Boc-NH-PEG2-NH-Boc, 97%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g, 25g, 50g, 100g.
Tert-butyl N-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethyl]carbamate (CAS 475591-59-4) is a chemical compound with the molecular formula C16H32N2O6 and a molecular weight of 348.43 g/mol. IUPAC name: tert-butyl N-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethyl]carbamate. InChIKey: IBOKAWABMPUDFK-UHFFFAOYSA-N.
| Molecular formula | C16H32N2O6 |
|---|---|
| Molecular weight | 348.43 g/mol |
| IUPAC name | tert-butyl N-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethyl]carbamate |
| InChIKey | IBOKAWABMPUDFK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)