cas: 502622-85-7 — see every product listed under this CAS number, including other names
5,5–dimethyl–2–(4–nitrophenyl)–1,3,2–dioxaborinane (CAS 502622-85-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF23302-100mg |
| cas | 502622-85-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 512.79 Pln | |
| GLPBio | 1g | 831.06 Pln | |
| GLPBio | 250mg | 545.55 Pln | |
| GLPBio | 5g | 1668.87 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
5,5-dimethyl-2-(4-nitrophenyl)-1,3,2-dioxaborinane (CAS 502622-85-7) is a chemical compound with the molecular formula C11H14BNO4 and a molecular weight of 235.05 g/mol. IUPAC name: 5,5-dimethyl-2-(4-nitrophenyl)-1,3,2-dioxaborinane. InChIKey: RRGGUJKPJNSZFX-UHFFFAOYSA-N.
| Molecular formula | C11H14BNO4 |
|---|---|
| Molecular weight | 235.05 g/mol |
| IUPAC name | 5,5-dimethyl-2-(4-nitrophenyl)-1,3,2-dioxaborinane |
| InChIKey | RRGGUJKPJNSZFX-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)