cas: 171178-46-4 — see every product listed under this CAS number, including other names
5-((tert-Butoxycarbonyl)amino)-2-chloroisonicotinic acid, 97%, 97% (CAS 171178-46-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11APJC-100mg |
| cas | 171178-46-4 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 414.80 Pln | |
| Chemat | 5g | 1283.60 Pln | |
| Chemat | 10g | 2157.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-chloro-5-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-4-carboxylic acid (CAS 171178-46-4) is a chemical compound with the molecular formula C11H13ClN2O4 and a molecular weight of 272.68 g/mol. IUPAC name: 2-chloro-5-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-4-carboxylic acid. InChIKey: KOSPRFUMGCNGFJ-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2O4 |
|---|---|
| Molecular weight | 272.68 g/mol |
| IUPAC name | 2-chloro-5-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-4-carboxylic acid |
| InChIKey | KOSPRFUMGCNGFJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CN=C(C=C1C(=O)O)Cl |
Computed by PubChem (NCBI)