cas: 171178-46-4 — see every product listed under this CAS number, including other names
5-((tert-Butoxycarbonyl)amino)-2-chloroisonicotinic acid, 97% (CAS 171178-46-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 25g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A409204-250mg |
| cas | 171178-46-4 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 467.11 Pln | |
| AmBeed | 25g | 10108.42 Pln | |
| AmBeed | 10g | 5089.21 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-chloro-5-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-4-carboxylic acid (CAS 171178-46-4) is a chemical compound with the molecular formula C11H13ClN2O4 and a molecular weight of 272.68 g/mol. IUPAC name: 2-chloro-5-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-4-carboxylic acid. InChIKey: KOSPRFUMGCNGFJ-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2O4 |
|---|---|
| Molecular weight | 272.68 g/mol |
| IUPAC name | 2-chloro-5-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-4-carboxylic acid |
| InChIKey | KOSPRFUMGCNGFJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CN=C(C=C1C(=O)O)Cl |
Computed by PubChem (NCBI)