cas: 56469-10-4 — see every product listed under this CAS number, including other names
5-(1,1-Dimethyl-heptyl)resorcinol, 95% (CAS 56469-10-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F011703-250MG |
| cas | 56469-10-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 122.89 Pln | |
| Fluorochem | 1g | 174.96 Pln | |
| Fluorochem | 5g | 388.42 Pln | |
| Fluorochem | 10g | 690.40 Pln | |
| Fluorochem | 25g | 1403.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
5-(2-methyloctan-2-yl)benzene-1,3-diol (CAS 56469-10-4) is a chemical compound with the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. IUPAC name: 5-(2-methyloctan-2-yl)benzene-1,3-diol. InChIKey: GWBGUJWRDDDVBI-UHFFFAOYSA-N.
| Molecular formula | C15H24O2 |
|---|---|
| Molecular weight | 236.35 g/mol |
| IUPAC name | 5-(2-methyloctan-2-yl)benzene-1,3-diol |
| InChIKey | GWBGUJWRDDDVBI-UHFFFAOYSA-N |
| SMILES | CCCCCCC(C)(C)C1=CC(=CC(=C1)O)O |
Computed by PubChem (NCBI)