cas: 1182741-45-2 — see every product listed under this CAS number, including other names
5-(2,2,2-Trifluoroacetamido)thiophene-2-carboxylic acid, 95% (CAS 1182741-45-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 500mg, 2.5g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch130HU9-50mg |
| cas | 1182741-45-2 |
| size | 50mg |
| availability | 15g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 736.40 Pln | |
| Chemat | 100mg | 1134.80 Pln | |
| Chemat | 250mg | 1850.00 Pln | |
| Chemat | 1g | 3458.00 Pln | |
| Chemat | 5g | 9760.40 Pln | |
| Fluorochem | 50mg | 929.90 Pln | |
| Fluorochem | 100mg | 1450.55 Pln | |
| Fluorochem | 250mg | 2356.48 Pln | |
| Fluorochem | 500mg | 3553.97 Pln | |
| Fluorochem | 1g | 4616.10 Pln | |
| Fluorochem | 2.5g | 8573.04 Pln | |
| Fluorochem | 5g | 12831.96 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-[(2,2,2-trifluoroacetyl)amino]thiophene-2-carboxylic acid (CAS 1182741-45-2) is a chemical compound with the molecular formula C7H4F3NO3S and a molecular weight of 239.17 g/mol. IUPAC name: 5-[(2,2,2-trifluoroacetyl)amino]thiophene-2-carboxylic acid. InChIKey: FKFIDDZHVBBKLZ-UHFFFAOYSA-N.
| Molecular formula | C7H4F3NO3S |
|---|---|
| Molecular weight | 239.17 g/mol |
| IUPAC name | 5-[(2,2,2-trifluoroacetyl)amino]thiophene-2-carboxylic acid |
| InChIKey | FKFIDDZHVBBKLZ-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)NC(=O)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)