5-(2,5-Dimethylphenoxy)pentanoic acid, 98%
cas: 443924-74-1 — see every product listed under this CAS number, including other names
5-(2,5-Dimethylphenoxy)pentanoic acid, 98% (CAS 443924-74-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 100mg, 250mg, 500mg, 1g, 2.5g. Offered by: AmBeed, Fluorochem, Chemat.
| brand | AmBeed |
|---|---|
| catalog number | A1112468-5g |
| cas | 443924-74-1 |
| size | 5g |
| availability | Synthetic Items: 0g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 4640.02 Pln | |
| AmBeed | 10g | 6807.85 Pln | |
| AmBeed | 100mg | 577.78 Pln | |
| Fluorochem | 100mg | 393.63 Pln | |
| Fluorochem | 250mg | 497.76 Pln | |
| Fluorochem | 500mg | 820.56 Pln | |
| Fluorochem | 1g | 1122.54 Pln | |
| Fluorochem | 2.5g | 2090.95 Pln | |
| Chemat | 100mg | 275.60 Pln | |
| Chemat | 250mg | 342.80 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-(2,5-dimethylphenoxy)pentanoic acid (CAS 443924-74-1) is a chemical compound with the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. IUPAC name: 5-(2,5-dimethylphenoxy)pentanoic acid. InChIKey: GDELSTPAOVZJKB-UHFFFAOYSA-N.
| Molecular formula | C13H18O3 |
|---|---|
| Molecular weight | 222.28 g/mol |
| IUPAC name | 5-(2,5-dimethylphenoxy)pentanoic acid |
| InChIKey | GDELSTPAOVZJKB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)OCCCCC(=O)O |
Computed by PubChem (NCBI)