cas: 1834596-58-5 — see every product listed under this CAS number, including other names
5-(2-Bromo-4-chlorophenyl)-1,3-oxazole, ≥95%, ≥95% (CAS 1834596-58-5) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11UD36-1g |
| cas | 1834596-58-5 |
| size | 1g |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2555.60 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
5-(2-bromo-4-chlorophenyl)-1,3-oxazole (CAS 1834596-58-5) is a chemical compound with the molecular formula C9H5BrClNO and a molecular weight of 258.50 g/mol. IUPAC name: 5-(2-bromo-4-chlorophenyl)-1,3-oxazole. InChIKey: HGEQCXOCMDGILJ-UHFFFAOYSA-N.
| Molecular formula | C9H5BrClNO |
|---|---|
| Molecular weight | 258.50 g/mol |
| IUPAC name | 5-(2-bromo-4-chlorophenyl)-1,3-oxazole |
| InChIKey | HGEQCXOCMDGILJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Br)C2=CN=CO2 |
Computed by PubChem (NCBI)