Products 1834596-58-5
CAS 1834596-58-5 appears in our catalog under these names: 5-(2-Bromo-4-chlorophenyl)-1,3-oxazole, 5-(2-Bromo-4-chlorophenyl)-1,3-oxazole, 95%, 5-(2-Bromo-4-chlorophenyl)-1,3-oxazole, ≥95%, ≥95%. Offered by: Fluorochem, Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 25g, 10g, 250mg.
5-(2-bromo-4-chlorophenyl)-1,3-oxazole (CAS 1834596-58-5) is a chemical compound with the molecular formula C9H5BrClNO and a molecular weight of 258.50 g/mol. IUPAC name: 5-(2-bromo-4-chlorophenyl)-1,3-oxazole. InChIKey: HGEQCXOCMDGILJ-UHFFFAOYSA-N.
| Molecular formula | C9H5BrClNO |
|---|---|
| Molecular weight | 258.50 g/mol |
| IUPAC name | 5-(2-bromo-4-chlorophenyl)-1,3-oxazole |
| InChIKey | HGEQCXOCMDGILJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Br)C2=CN=CO2 |
Computed by PubChem (NCBI)