cas: 50907-46-5 — see every product listed under this CAS number, including other names
5-(2-Chlorophenyl)-1H-tetrazole, 98+%, 98+% (CAS 50907-46-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114M4N-250mg |
| cas | 50907-46-5 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 280.40 Pln | |
| Chemat | 25g | 1067.60 Pln |
| purity | 98+% |
|---|---|
| delivery time | 3 weeks |
5-(2-chlorophenyl)-2H-tetrazole (CAS 50907-46-5) is a chemical compound with the molecular formula C7H5ClN4 and a molecular weight of 180.59 g/mol. IUPAC name: 5-(2-chlorophenyl)-2H-tetrazole. InChIKey: PSUIIKIEUATWCZ-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN4 |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | 5-(2-chlorophenyl)-2H-tetrazole |
| InChIKey | PSUIIKIEUATWCZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NNN=N2)Cl |
Computed by PubChem (NCBI)