CAS 5423-53-0 appears in our catalog under these names: 3-Amino-7-chloro-1,2,4-benzotriazine, 98%, 3-Amino-7-chloro-1,2,4-benzotriazine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
7-chloro-1,2,4-benzotriazin-3-amine (CAS 5423-53-0) is a chemical compound with the molecular formula C7H5ClN4 and a molecular weight of 180.59 g/mol. IUPAC name: 7-chloro-1,2,4-benzotriazin-3-amine. InChIKey: KTIMFFFWQOYBMI-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN4 |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | 7-chloro-1,2,4-benzotriazin-3-amine |
| InChIKey | KTIMFFFWQOYBMI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)N=NC(=N2)N |
Computed by PubChem (NCBI)