cas: 34035-04-6 — see every product listed under this CAS number, including other names
5-(2-Chlorophenyl)furan-2-carbaldehyde 98% (CAS 34035-04-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A646966-250mg |
| cas | 34035-04-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 359.25 Pln | |
| Ambeed | 5g | 932.19 Pln | |
| Ambeed | 10g | 1221.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A646966 |
5-(2-chlorophenyl)furan-2-carbaldehyde (CAS 34035-04-6) is a chemical compound with the molecular formula C11H7ClO2 and a molecular weight of 206.62 g/mol. IUPAC name: 5-(2-chlorophenyl)furan-2-carbaldehyde. InChIKey: ONQOZTFAOFZDFK-UHFFFAOYSA-N.
| Molecular formula | C11H7ClO2 |
|---|---|
| Molecular weight | 206.62 g/mol |
| IUPAC name | 5-(2-chlorophenyl)furan-2-carbaldehyde |
| InChIKey | ONQOZTFAOFZDFK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(O2)C=O)Cl |
Computed by PubChem (NCBI)