CAS 1013-04-3 appears in our catalog under these names: 4-Chloro-1-naphthoic acid, 95%, 4-Chloro-1-napthalenecarboxylic Acid, >95% (HPLC), 4–Chloro–1–naphthoic acid, 4-Chloro-1-naphthoic acid 98%, 4-Chloro-1-naphthoic acid, 98%, 98%. Offered by: Combi-blocks, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: 10g, 1g, 5g, 250mg, 2,5g, 100mg, 25g.
4-chloronaphthalene-1-carboxylic acid (CAS 1013-04-3) is a chemical compound with the molecular formula C11H7ClO2 and a molecular weight of 206.62 g/mol. IUPAC name: 4-chloronaphthalene-1-carboxylic acid. InChIKey: SHCCGXNIGGRSMX-UHFFFAOYSA-N.
| Molecular formula | C11H7ClO2 |
|---|---|
| Molecular weight | 206.62 g/mol |
| IUPAC name | 4-chloronaphthalene-1-carboxylic acid |
| InChIKey | SHCCGXNIGGRSMX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2Cl)C(=O)O |
Computed by PubChem (NCBI)