cas: 474327-26-9 — see every product listed under this CAS number, including other names
5-(2-Chloropyridin-4-yl)-1,3,4-thiadiazol-2-amine, 95%+, 95%+ (CAS 474327-26-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I9NA-100mg |
| cas | 474327-26-9 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 500mg | 227.60 Pln | |
| Chemat | 1g | 338.00 Pln | |
| Chemat | 5g | 1163.60 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
5-(2-chloro-4-pyridinyl)-1,3,4-thiadiazol-2-amine (CAS 474327-26-9) is a chemical compound with the molecular formula C7H5ClN4S and a molecular weight of 212.66 g/mol. IUPAC name: 5-(2-chloro-4-pyridinyl)-1,3,4-thiadiazol-2-amine. InChIKey: TVSGIIMMTMDKRU-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN4S |
|---|---|
| Molecular weight | 212.66 g/mol |
| IUPAC name | 5-(2-chloro-4-pyridinyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | TVSGIIMMTMDKRU-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1C2=NN=C(S2)N)Cl |
Computed by PubChem (NCBI)