CAS 176637-10-8 appears in our catalog under these names: 8-Chloro-2-(methylthio)pyrimido[5,4-d]pyrimidine, 95%, 8-Chloro-2-(methylthio)pyrimido(5,4-d)pyrimidine, 95%, 8–Chloro–2–(methylthio)pyrimido(5,4–d)pyrimidine, 8-Chloro-2-(methylthio)pyrimido[5,4-d]pyrimidine 95%, 8-Chloro-2-(methylthio)pyrimido[5,4-d]pyrimidine, 97%, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g, 25g, 50g, 100g.
4-chloro-6-methylsulfanylpyrimido[5,4-d]pyrimidine (CAS 176637-10-8) is a chemical compound with the molecular formula C7H5ClN4S and a molecular weight of 212.66 g/mol. IUPAC name: 4-chloro-6-methylsulfanylpyrimido[5,4-d]pyrimidine. InChIKey: YBAUXEUJXJTKCH-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN4S |
|---|---|
| Molecular weight | 212.66 g/mol |
| IUPAC name | 4-chloro-6-methylsulfanylpyrimido[5,4-d]pyrimidine |
| InChIKey | YBAUXEUJXJTKCH-UHFFFAOYSA-N |
| SMILES | CSC1=NC=C2C(=N1)C(=NC=N2)Cl |
Computed by PubChem (NCBI)