cas: 881674-56-2 — see every product listed under this CAS number, including other names
5-(2-Fluorophenyl)-1H-pyrrole-3-carbaldehyde, 98%, 98% (CAS 881674-56-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 50g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1140NL-1g |
| cas | 881674-56-2 |
| size | 1g |
| availability | 772.24g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 10g | 102.80 Pln | |
| Chemat | 25g | 146.00 Pln | |
| Chemat | 100g | 371.60 Pln | |
| Chemat | 500g | 1372.80 Pln | |
| Chemat | 50g | 222.80 Pln | |
| Chemat | 250g | 750.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-(2-fluorophenyl)-1H-pyrrole-3-carbaldehyde (CAS 881674-56-2) is a chemical compound with the molecular formula C11H8FNO and a molecular weight of 189.19 g/mol. IUPAC name: 5-(2-fluorophenyl)-1H-pyrrole-3-carbaldehyde. InChIKey: MQULPEUCGKEHEG-UHFFFAOYSA-N.
| Molecular formula | C11H8FNO |
|---|---|
| Molecular weight | 189.19 g/mol |
| IUPAC name | 5-(2-fluorophenyl)-1H-pyrrole-3-carbaldehyde |
| InChIKey | MQULPEUCGKEHEG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=CN2)C=O)F |
Computed by PubChem (NCBI)