5-(2-Hydroxyethylamino)-2-methoxylaniline sulfate 95%
cas: 83763-48-8 — see every product listed under this CAS number, including other names
5-(2-Hydroxyethylamino)-2-methoxylaniline sulfate 95% (CAS 83763-48-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A154917-1g |
| cas | 83763-48-8 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 136.75 Pln | |
| Ambeed | 5g | 259.12 Pln | |
| Ambeed | 25g | 698.56 Pln | |
| Ambeed | 100g | 1877.81 Pln | |
| Ambeed | 500g | 5754.88 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A154917 |
2-(3-amino-4-methoxyanilino)ethanol;sulfuric acid (CAS 83763-48-8) is a chemical compound with the molecular formula C9H16N2O6S and a molecular weight of 280.30 g/mol. IUPAC name: 2-(3-amino-4-methoxyanilino)ethanol;sulfuric acid. InChIKey: GWHLYFOWAINYAH-UHFFFAOYSA-N.
| Molecular formula | C9H16N2O6S |
|---|---|
| Molecular weight | 280.30 g/mol |
| IUPAC name | 2-(3-amino-4-methoxyanilino)ethanol;sulfuric acid |
| InChIKey | GWHLYFOWAINYAH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)NCCO)N.OS(=O)(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-Amino-4-hydroxyethylaminoanisole sulfate, jarocol ahea, 2-((3-Amino-4-methoxyphenyl)amino)ethanol sulfate, COVASTYLE AHEAS, 2-Amino-4-[(2-hydroxyethyl)amino]anisole Sulfate, 2-Amino-4-((2-hydroxyethyl)amino)anisole sulfate, 5-(2-Hydroxyethylamino)-2-methoxylaniline sulfate, 2-Amino-4-hydroxyethylamino anisole sulfate, 2-(3-amino-4-methoxyanilino)ethanol;sulfuric acid, 2-[(3-amino-4-methoxyphenyl)amino]ethan-1-ol; sulfuric acid