CAS 83763-48-8 appears in our catalog under these names: 5-(2-Hydroxyethylamino)-2-methoxylaniline sulfate, 95%, 5-(2-Hydroxyethylamino)-2-methoxylaniline sulfate, >95% (HPLC), 2-((3-Amino-4-methoxyphenyl)amino)ethanol sulfate, 5-(2-Hydroxyethylamino)-2-methoxylaniline sulfate 95%, 2-((3-Amino-4-methoxyphenyl)amino)ethan-1-ol sulfate (Standard). Offered by: Combi-blocks, TRC, Biosynth, Ambeed, MedChemExpress. Available pack sizes: 10g, 100g, 5g, 25g, 1g, 500mg, 50g, 500g.
2-(3-amino-4-methoxyanilino)ethanol;sulfuric acid (CAS 83763-48-8) is a chemical compound with the molecular formula C9H16N2O6S and a molecular weight of 280.30 g/mol. IUPAC name: 2-(3-amino-4-methoxyanilino)ethanol;sulfuric acid. InChIKey: GWHLYFOWAINYAH-UHFFFAOYSA-N.
| Molecular formula | C9H16N2O6S |
|---|---|
| Molecular weight | 280.30 g/mol |
| IUPAC name | 2-(3-amino-4-methoxyanilino)ethanol;sulfuric acid |
| InChIKey | GWHLYFOWAINYAH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)NCCO)N.OS(=O)(=O)O |
Computed by PubChem (NCBI)