cas: 1962928-21-7 — see every product listed under this CAS number, including other names
5-(3,5-Dimethyl-4-isoxazolyl)-1-[2-(4-morpholinyl)ethyl]-2-[2-(4-propoxyphenyl)ethyl]-1H-benzimidazole (CAS 1962928-21-7) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 2mg, 5mg, 25mg, 10mg, 50mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DU0O-1mg |
| cas | 1962928-21-7 |
| size | 1mg |
| availability | 0.1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 184.40 Pln | |
| Chemat | 2mg | 198.80 Pln | |
| Chemat | 5mg | 314.00 Pln | |
| Chemat | 25mg | 923.60 Pln | |
| Chemat | 10mg | 506.00 Pln | |
| Chemat | 50mg | 1619.60 Pln | |
| Chemat | 100mg | 2296.40 Pln |
| delivery time | 3 weeks |
|---|
4-[2-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-[2-(4-propoxyphenyl)ethyl]benzimidazol-1-yl]ethyl]morpholine (CAS 1962928-21-7) is a chemical compound with the molecular formula C29H36N4O3 and a molecular weight of 488.6 g/mol. IUPAC name: 4-[2-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-[2-(4-propoxyphenyl)ethyl]benzimidazol-1-yl]ethyl]morpholine. InChIKey: CGWBJJZOKGZCSJ-UHFFFAOYSA-N.
| Molecular formula | C29H36N4O3 |
|---|---|
| Molecular weight | 488.6 g/mol |
| IUPAC name | 4-[2-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-[2-(4-propoxyphenyl)ethyl]benzimidazol-1-yl]ethyl]morpholine |
| InChIKey | CGWBJJZOKGZCSJ-UHFFFAOYSA-N |
| SMILES | CCCOC1=CC=C(C=C1)CCC2=NC3=C(N2CCN4CCOCC4)C=CC(=C3)C5=C(ON=C5C)C |
Computed by PubChem (NCBI)