CAS 3034605-72-3 is the registry number for HVH-2930, 96.54%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 5 mg, 25 mg, 10 mg, 50 mg.
5-methoxy-2,2-dimethyl-N-[3-methyl-1-[2-(1-methylpiperidin-4-yl)ethyl]indazol-6-yl]chromene-6-carboxamide (CAS 3034605-72-3) is a chemical compound with the molecular formula C29H36N4O3 and a molecular weight of 488.6 g/mol. IUPAC name: 5-methoxy-2,2-dimethyl-N-[3-methyl-1-[2-(1-methylpiperidin-4-yl)ethyl]indazol-6-yl]chromene-6-carboxamide. InChIKey: DBAWJYXZNCEOOW-UHFFFAOYSA-N.
| Molecular formula | C29H36N4O3 |
|---|---|
| Molecular weight | 488.6 g/mol |
| IUPAC name | 5-methoxy-2,2-dimethyl-N-[3-methyl-1-[2-(1-methylpiperidin-4-yl)ethyl]indazol-6-yl]chromene-6-carboxamide |
| InChIKey | DBAWJYXZNCEOOW-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C=CC(=C2)NC(=O)C3=C(C4=C(C=C3)OC(C=C4)(C)C)OC)CCC5CCN(CC5)C |
Computed by PubChem (NCBI)