cas: 1093819-50-1 — see every product listed under this CAS number, including other names
5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazolo[3,4-b]pyridine, 97%, 97% (CAS 1093819-50-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1193JC-250mg |
| cas | 1093819-50-1 |
| size | 250mg |
| availability | 0.7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 93.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazolo[5,4-b]pyridine (CAS 1093819-50-1) is a chemical compound with the molecular formula C12H16BN3O2 and a molecular weight of 245.09 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazolo[5,4-b]pyridine. InChIKey: TZNNEHGHACAHPF-UHFFFAOYSA-N.
| Molecular formula | C12H16BN3O2 |
|---|---|
| Molecular weight | 245.09 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazolo[5,4-b]pyridine |
| InChIKey | TZNNEHGHACAHPF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(NN=C3)N=C2 |
Computed by PubChem (NCBI)