cas: 1045809-78-6 — see every product listed under this CAS number, including other names
5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)isothiazole, 98% (CAS 1045809-78-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F223532-100MG |
| cas | 1045809-78-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 752.88 Pln | |
| Fluorochem | 250mg | 1237.08 Pln | |
| Fluorochem | 1g | 3246.79 Pln | |
| Fluorochem | 5g | 12602.87 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-thiazole (CAS 1045809-78-6) is a chemical compound with the molecular formula C9H14BNO2S and a molecular weight of 211.09 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-thiazole. InChIKey: UPECZVDBUMIIIL-UHFFFAOYSA-N.
| Molecular formula | C9H14BNO2S |
|---|---|
| Molecular weight | 211.09 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-thiazole |
| InChIKey | UPECZVDBUMIIIL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=NS2 |
Computed by PubChem (NCBI)