cas: 848093-29-8 — see every product listed under this CAS number, including other names
5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)nicotinaldehyde, 98% (CAS 848093-29-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F231108-250MG |
| cas | 848093-29-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 195.78 Pln | |
| Fluorochem | 5g | 612.30 Pln | |
| Fluorochem | 10g | 976.76 Pln | |
| Fluorochem | 25g | 2158.63 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carbaldehyde (CAS 848093-29-8) is a chemical compound with the molecular formula C12H16BNO3 and a molecular weight of 233.07 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carbaldehyde. InChIKey: WVIMCYHOZKNOCS-UHFFFAOYSA-N.
| Molecular formula | C12H16BNO3 |
|---|---|
| Molecular weight | 233.07 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carbaldehyde |
| InChIKey | WVIMCYHOZKNOCS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2)C=O |
Computed by PubChem (NCBI)