cas: 402718-29-0 — see every product listed under this CAS number, including other names
5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)nicotinonitrile, 97% (CAS 402718-29-0) is a chemical reagent available from Chemat. Available pack sizes: 25g, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F222821-25G |
| cas | 402718-29-0 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 3371.75 Pln | |
| Fluorochem | 1g | 206.20 Pln | |
| Fluorochem | 5g | 726.85 Pln | |
| Fluorochem | 10g | 1403.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carbonitrile (CAS 402718-29-0) is a chemical compound with the molecular formula C12H15BN2O2 and a molecular weight of 230.07 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carbonitrile. InChIKey: BOIKCRIMIQAFQJ-UHFFFAOYSA-N.
| Molecular formula | C12H15BN2O2 |
|---|---|
| Molecular weight | 230.07 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carbonitrile |
| InChIKey | BOIKCRIMIQAFQJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2)C#N |
Computed by PubChem (NCBI)