cas: 1054483-78-1 — see every product listed under this CAS number, including other names
5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-ol 97% (CAS 1054483-78-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A872110-100mg |
| cas | 1054483-78-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 759.75 Pln | |
| Ambeed | 25g | 2584.25 Pln | |
| Ambeed | 100g | 7295.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A872110 |
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyridin-2-one (CAS 1054483-78-1) is a chemical compound with the molecular formula C11H16BNO3 and a molecular weight of 221.06 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyridin-2-one. InChIKey: WAUWXCUPDOXYKS-UHFFFAOYSA-N.
| Molecular formula | C11H16BNO3 |
|---|---|
| Molecular weight | 221.06 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyridin-2-one |
| InChIKey | WAUWXCUPDOXYKS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CNC(=O)C=C2 |
Computed by PubChem (NCBI)