cas: 1025708-31-9 — see every product listed under this CAS number, including other names
5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine-2-carbonitrile, 95% (CAS 1025708-31-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F338018-1G |
| cas | 1025708-31-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 206.20 Pln | |
| Fluorochem | 5g | 638.33 Pln | |
| Fluorochem | 25g | 2221.11 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine-2-carbonitrile (CAS 1025708-31-9) is a chemical compound with the molecular formula C11H14BN3O2 and a molecular weight of 231.06 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine-2-carbonitrile. InChIKey: KJQVHJSIJTVCMN-UHFFFAOYSA-N.
| Molecular formula | C11H14BN3O2 |
|---|---|
| Molecular weight | 231.06 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine-2-carbonitrile |
| InChIKey | KJQVHJSIJTVCMN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)C#N |
Computed by PubChem (NCBI)