CAS 1186041-94-0 is the registry number for 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine-2-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine-2-carbonitrile (CAS 1186041-94-0) is a chemical compound with the molecular formula C11H14BN3O2 and a molecular weight of 231.06 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine-2-carbonitrile. InChIKey: YEFPDBKMJRIBKT-UHFFFAOYSA-N.
| Molecular formula | C11H14BN3O2 |
|---|---|
| Molecular weight | 231.06 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine-2-carbonitrile |
| InChIKey | YEFPDBKMJRIBKT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=N2)C#N |
Computed by PubChem (NCBI)