cas: 1086111-09-2 — see every product listed under this CAS number, including other names
5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)thiazole, 95% (CAS 1086111-09-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F214705-100MG |
| cas | 1086111-09-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 102.07 Pln | |
| Fluorochem | 250mg | 128.10 Pln | |
| Fluorochem | 1g | 159.34 Pln | |
| Fluorochem | 5g | 404.04 Pln | |
| Fluorochem | 10g | 659.16 Pln | |
| Fluorochem | 25g | 1565.09 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole (CAS 1086111-09-2) is a chemical compound with the molecular formula C9H14BNO2S and a molecular weight of 211.09 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole. InChIKey: ODYWLZYOVWNCGN-UHFFFAOYSA-N.
| Molecular formula | C9H14BNO2S |
|---|---|
| Molecular weight | 211.09 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole |
| InChIKey | ODYWLZYOVWNCGN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=CS2 |
Computed by PubChem (NCBI)