cas: 1034579-02-6 — see every product listed under this CAS number, including other names
5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)thieno[2,3-b]pyridine, 98%, 98% (CAS 1034579-02-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110515-100mg |
| cas | 1034579-02-6 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 213.20 Pln | |
| Chemat | 250mg | 400.40 Pln | |
| Chemat | 1g | 1370.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thieno[2,3-b]pyridine (CAS 1034579-02-6) is a chemical compound with the molecular formula C13H16BNO2S and a molecular weight of 261.2 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thieno[2,3-b]pyridine. InChIKey: ZFALGGJIXOGZJQ-UHFFFAOYSA-N.
| Molecular formula | C13H16BNO2S |
|---|---|
| Molecular weight | 261.2 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thieno[2,3-b]pyridine |
| InChIKey | ZFALGGJIXOGZJQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(N=C2)SC=C3 |
Computed by PubChem (NCBI)