CAS 2230209-53-5 appears in our catalog under these names: 4-(tetramethyl-1,3,2-dioxaborolan-2-yl)thieno[2,3-c]pyridine, 95%, 4-(Tetramethyl-1,3,2-dioxaborolan-2-yl)thieno(2,3-c)pyridine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 50mg, 0,5g.
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thieno[2,3-c]pyridine (CAS 2230209-53-5) is a chemical compound with the molecular formula C13H16BNO2S and a molecular weight of 261.2 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thieno[2,3-c]pyridine. InChIKey: ZLKKGJISYOYDIA-UHFFFAOYSA-N.
| Molecular formula | C13H16BNO2S |
|---|---|
| Molecular weight | 261.2 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thieno[2,3-c]pyridine |
| InChIKey | ZLKKGJISYOYDIA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=CC3=C2C=CS3 |
Computed by PubChem (NCBI)