cas: 1040281-83-1 — see every product listed under this CAS number, including other names
5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carbaldehyde, 97% (CAS 1040281-83-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F320700-1G |
| cas | 1040281-83-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 133.30 Pln | |
| Fluorochem | 10g | 164.54 Pln | |
| Fluorochem | 25g | 315.53 Pln | |
| Fluorochem | 100g | 955.93 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carbaldehyde (CAS 1040281-83-1) is a chemical compound with the molecular formula C11H15BO3S and a molecular weight of 238.12 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carbaldehyde. InChIKey: OVGYVJMTHQRCDB-UHFFFAOYSA-N.
| Molecular formula | C11H15BO3S |
|---|---|
| Molecular weight | 238.12 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carbaldehyde |
| InChIKey | OVGYVJMTHQRCDB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(S2)C=O |
Computed by PubChem (NCBI)