cas: 916454-59-6 — see every product listed under this CAS number, including other names
5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carbonitrile 98% (CAS 916454-59-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A383039-50mg |
| cas | 916454-59-6 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 1121.31 Pln | |
| Ambeed | 100mg | 1861.13 Pln | |
| Ambeed | 250mg | 3112.69 Pln | |
| Ambeed | 1g | 7985.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A383039 |
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carbonitrile (CAS 916454-59-6) is a chemical compound with the molecular formula C11H14BNO2S and a molecular weight of 235.11 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carbonitrile. InChIKey: OXYRAUHWTSONAV-UHFFFAOYSA-N.
| Molecular formula | C11H14BNO2S |
|---|---|
| Molecular weight | 235.11 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carbonitrile |
| InChIKey | OXYRAUHWTSONAV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CS2)C#N |
Computed by PubChem (NCBI)