cas: 506407-84-7 — see every product listed under this CAS number, including other names
5-(4-(tert-Butyl)phenyl)-1,3,4-oxadiazol-2-amine, 97%, 97% (CAS 506407-84-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11E8SZ-50mg |
| cas | 506407-84-7 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 1096.40 Pln | |
| Chemat | 100mg | 1442.00 Pln | |
| Chemat | 250mg | 2474.00 Pln | |
| Chemat | 1g | 5022.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-amine (CAS 506407-84-7) is a chemical compound with the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. IUPAC name: 5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-amine. InChIKey: OISTTWCWVFSFNE-UHFFFAOYSA-N.
| Molecular formula | C12H15N3O |
|---|---|
| Molecular weight | 217.27 g/mol |
| IUPAC name | 5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-amine |
| InChIKey | OISTTWCWVFSFNE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=NN=C(O2)N |
Computed by PubChem (NCBI)