cas: 2002638-40-4 — see every product listed under this CAS number, including other names
5-(4-Bromo-2-chlorophenyl)oxazole, 95%, 95% (CAS 2002638-40-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch132PXY-250mg |
| cas | 2002638-40-4 |
| size | 250mg |
| availability | 40g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 2013.20 Pln | |
| Chemat | 1g | 3784.40 Pln | |
| Chemat | 5g | 17786.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-(4-bromo-2-chlorophenyl)-1,3-oxazole (CAS 2002638-40-4) is a chemical compound with the molecular formula C9H5BrClNO and a molecular weight of 258.50 g/mol. IUPAC name: 5-(4-bromo-2-chlorophenyl)-1,3-oxazole. InChIKey: NZRPUBFMZMHLSU-UHFFFAOYSA-N.
| Molecular formula | C9H5BrClNO |
|---|---|
| Molecular weight | 258.50 g/mol |
| IUPAC name | 5-(4-bromo-2-chlorophenyl)-1,3-oxazole |
| InChIKey | NZRPUBFMZMHLSU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)Cl)C2=CN=CO2 |
Computed by PubChem (NCBI)