5-(4-Bromophenoxy)pentanoic acid, 95%
cas: 87411-38-9 — see every product listed under this CAS number, including other names
5-(4-Bromophenoxy)pentanoic acid, 95% (CAS 87411-38-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 25g, 100g. Offered by: Combi-blocks, Ambeed, Chemat, BLDpharm.
| brand | Combi-blocks |
|---|---|
| catalog number | JK-0331-5g |
| cas | 87411-38-9 |
| size | 5g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 100mg | price on request | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 570.62 Pln | |
| Ambeed | 5g | 1471.75 Pln | |
| Chemat | 250mg | 482.00 Pln | |
| Chemat | 1g | 1192.40 Pln | |
| Chemat | 5g | 3347.60 Pln | |
| BLDpharm | 1g | 614.25 Pln | |
| BLDpharm | 5g | 1752.74 Pln | |
| BLDpharm | 10g | 2863.46 Pln | |
| BLDpharm | 25g | 5662.48 Pln | |
| BLDpharm | 100g | 22428.79 Pln | |
| Fluorochem | 250mg | 883.04 Pln | |
| Fluorochem | 1g | 2210.70 Pln | |
| Fluorochem | 5g | 6209.29 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
5-(4-bromophenoxy)pentanoic acid (CAS 87411-38-9) is a chemical compound with the molecular formula C11H13BrO3 and a molecular weight of 273.12 g/mol. IUPAC name: 5-(4-bromophenoxy)pentanoic acid. InChIKey: KACNEIIGTGEGPZ-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO3 |
|---|---|
| Molecular weight | 273.12 g/mol |
| IUPAC name | 5-(4-bromophenoxy)pentanoic acid |
| InChIKey | KACNEIIGTGEGPZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OCCCCC(=O)O)Br |
Computed by PubChem (NCBI)