cas: 52063-43-1 — see every product listed under this CAS number, including other names
5-(4-Bromophenyl)-3-methylisoxazole (CAS 52063-43-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F723034-250MG |
| cas | 52063-43-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1049.65 Pln | |
| Fluorochem | 1g | 2434.58 Pln |
| delivery time | 3-4 weeks |
|---|
5-(4-bromophenyl)-3-methyl-1,2-oxazole (CAS 52063-43-1) is a chemical compound with the molecular formula C10H8BrNO and a molecular weight of 238.08 g/mol. IUPAC name: 5-(4-bromophenyl)-3-methyl-1,2-oxazole. InChIKey: AKCVUKKYCZTWKS-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO |
|---|---|
| Molecular weight | 238.08 g/mol |
| IUPAC name | 5-(4-bromophenyl)-3-methyl-1,2-oxazole |
| InChIKey | AKCVUKKYCZTWKS-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=C1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)