5-(4-Fluorophenyl)pyrrolidin-2-one, 98%
cas: 90432-58-9 — see every product listed under this CAS number, including other names
5-(4-Fluorophenyl)pyrrolidin-2-one, 98% (CAS 90432-58-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A571608-250mg |
| cas | 90432-58-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 403.75 Pln | |
| Ambeed | 1g | 954.44 Pln | |
| Ambeed | 5g | 3157.19 Pln | |
| BLDpharm | 250mg | 430.98 Pln | |
| BLDpharm | 1g | 1025.22 Pln | |
| BLDpharm | 5g | 3396.61 Pln | |
| Chemat | 250mg | 419.60 Pln | |
| Chemat | 1g | 1024.40 Pln | |
| Chemat | 5g | 2469.20 Pln | |
| Fluorochem | 5g | 3246.79 Pln | |
| Fluorochem | 250mg | 404.04 Pln | |
| Fluorochem | 1g | 981.96 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
5-(4-fluorophenyl)pyrrolidin-2-one (CAS 90432-58-9) is a chemical compound with the molecular formula C10H10FNO and a molecular weight of 179.19 g/mol. IUPAC name: 5-(4-fluorophenyl)pyrrolidin-2-one. InChIKey: PMDKRVJPWNBFEM-UHFFFAOYSA-N.
| Molecular formula | C10H10FNO |
|---|---|
| Molecular weight | 179.19 g/mol |
| IUPAC name | 5-(4-fluorophenyl)pyrrolidin-2-one |
| InChIKey | PMDKRVJPWNBFEM-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC1C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)