cas: 571189-49-6 — see every product listed under this CAS number, including other names
5-(4-Methylpiperazin-1-yl)pyridin-2-amine 98% (CAS 571189-49-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A120592-250mg |
| cas | 571189-49-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 270.25 Pln | |
| Ambeed | 25g | 414.88 Pln | |
| Ambeed | 100g | 1343.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A120592 |
5-(4-methylpiperazin-1-yl)pyridin-2-amine (CAS 571189-49-6) is a chemical compound with the molecular formula C10H16N4 and a molecular weight of 192.26 g/mol. IUPAC name: 5-(4-methylpiperazin-1-yl)pyridin-2-amine. InChIKey: QDMPMBFLXOWHRY-UHFFFAOYSA-N.
| Molecular formula | C10H16N4 |
|---|---|
| Molecular weight | 192.26 g/mol |
| IUPAC name | 5-(4-methylpiperazin-1-yl)pyridin-2-amine |
| InChIKey | QDMPMBFLXOWHRY-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=CN=C(C=C2)N |
Computed by PubChem (NCBI)