cas: 194490-25-0 — see every product listed under this CAS number, including other names
5-(Benzyloxy)-1H-indole-3-carbonitrile, 95%, 95% (CAS 194490-25-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AQPP-100mg |
| cas | 194490-25-0 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 414.80 Pln | |
| Chemat | 5g | 1821.20 Pln | |
| Chemat | 10g | 3573.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-phenylmethoxy-1H-indole-3-carbonitrile (CAS 194490-25-0) is a chemical compound with the molecular formula C16H12N2O and a molecular weight of 248.28 g/mol. IUPAC name: 5-phenylmethoxy-1H-indole-3-carbonitrile. InChIKey: SRDVYVLUUTYYSA-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | 5-phenylmethoxy-1H-indole-3-carbonitrile |
| InChIKey | SRDVYVLUUTYYSA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC3=C(C=C2)NC=C3C#N |
Computed by PubChem (NCBI)