cas: 95741-44-9 — see every product listed under this CAS number, including other names
5-(Benzyloxy)-2-bromo-1,3-dimethylbenzene, 97% (CAS 95741-44-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A115502-5g |
| cas | 95741-44-9 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 13610.80 Pln | |
| AmBeed | 10g | 23089.36 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-bromo-1,3-dimethyl-5-phenylmethoxybenzene (CAS 95741-44-9) is a chemical compound with the molecular formula C15H15BrO and a molecular weight of 291.18 g/mol. IUPAC name: 2-bromo-1,3-dimethyl-5-phenylmethoxybenzene. InChIKey: LXPOYZVSGGMEMK-UHFFFAOYSA-N.
| Molecular formula | C15H15BrO |
|---|---|
| Molecular weight | 291.18 g/mol |
| IUPAC name | 2-bromo-1,3-dimethyl-5-phenylmethoxybenzene |
| InChIKey | LXPOYZVSGGMEMK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1Br)C)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)