cas: 2244668-88-8 — see every product listed under this CAS number, including other names
5-(Benzyloxy)benzo(c)(1,2)oxaborol-1(3H)-ol, 98% (CAS 2244668-88-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1149216-10g |
| cas | 2244668-88-8 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 9802.45 Pln | |
| AmBeed | 25g | 19196.38 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-hydroxy-5-phenylmethoxy-3H-2,1-benzoxaborole (CAS 2244668-88-8) is a chemical compound with the molecular formula C14H13BO3 and a molecular weight of 240.06 g/mol. IUPAC name: 1-hydroxy-5-phenylmethoxy-3H-2,1-benzoxaborole. InChIKey: PVEXXABNMJDDDJ-UHFFFAOYSA-N.
| Molecular formula | C14H13BO3 |
|---|---|
| Molecular weight | 240.06 g/mol |
| IUPAC name | 1-hydroxy-5-phenylmethoxy-3H-2,1-benzoxaborole |
| InChIKey | PVEXXABNMJDDDJ-UHFFFAOYSA-N |
| SMILES | B1(C2=C(CO1)C=C(C=C2)OCC3=CC=CC=C3)O |
Computed by PubChem (NCBI)