CAS 2244668-88-8 appears in our catalog under these names: 5-Benzyloxy-1,3-dihydro-2,1-benzoxaborol-1-ol, 97%, 5-(Benzyloxy)benzo(c)(1,2)oxaborol-1(3H)-ol, 98%, 5-Benzyloxy-1,3-dihydro-2,1-benzoxaborol-1-ol. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
1-hydroxy-5-phenylmethoxy-3H-2,1-benzoxaborole (CAS 2244668-88-8) is a chemical compound with the molecular formula C14H13BO3 and a molecular weight of 240.06 g/mol. IUPAC name: 1-hydroxy-5-phenylmethoxy-3H-2,1-benzoxaborole. InChIKey: PVEXXABNMJDDDJ-UHFFFAOYSA-N.
| Molecular formula | C14H13BO3 |
|---|---|
| Molecular weight | 240.06 g/mol |
| IUPAC name | 1-hydroxy-5-phenylmethoxy-3H-2,1-benzoxaborole |
| InChIKey | PVEXXABNMJDDDJ-UHFFFAOYSA-N |
| SMILES | B1(C2=C(CO1)C=C(C=C2)OCC3=CC=CC=C3)O |
Computed by PubChem (NCBI)