5-(Biotinamido)pentylamine, 97%, 97%
cas: 115416-38-1 — see every product listed under this CAS number, including other names
5-(Biotinamido)pentylamine, 97%, 97% (CAS 115416-38-1) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119SPO-10mg |
| cas | 115416-38-1 |
| size | 10mg |
| availability | 10g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 419.60 Pln | |
| Chemat | 25mg | 630.80 Pln | |
| Chemat | 50mg | 741.20 Pln | |
| Chemat | 100mg | 1149.20 Pln | |
| Chemat | 250mg | 2776.40 Pln | |
| Chemat | 5g | 3448.40 Pln | |
| Chemat | 10g | 6328.40 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(5-aminopentyl)pentanamide (CAS 115416-38-1) is a chemical compound with the molecular formula C15H28N4O2S and a molecular weight of 328.5 g/mol. IUPAC name: 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(5-aminopentyl)pentanamide. InChIKey: CCSGGWGTGOLEHK-OBJOEFQTSA-N.
| Molecular formula | C15H28N4O2S |
|---|---|
| Molecular weight | 328.5 g/mol |
| IUPAC name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(5-aminopentyl)pentanamide |
| InChIKey | CCSGGWGTGOLEHK-OBJOEFQTSA-N |
| SMILES | C1[C@H]2[C@@H]([C@@H](S1)CCCCC(=O)NCCCCCN)NC(=O)N2 |
Computed by PubChem (NCBI)