Biotinyl cadaverine
cas: 115416-38-1 — see every product listed under this CAS number, including other names
Biotinyl cadaverine (CAS 115416-38-1) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 500mg, 1g, 5g. Offered by: Iris Biotech.
| brand | Iris Biotech |
|---|---|
| catalog number | LS-1670.0025 |
| cas | 115416-38-1 |
| size | 25mg |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Iris Biotech | 25mg | 405.94 Pln | |
| Iris Biotech | 50mg | 551.41 Pln | |
| Iris Biotech | 100mg | 772.11 Pln | |
| Iris Biotech | 250mg | 1213.52 Pln | |
| Iris Biotech | 500mg | 2096.34 Pln | |
| Iris Biotech | 1g | 3199.86 Pln | |
| Iris Biotech | 5g | 11145.20 Pln |
properties
| purity | No data |
|---|---|
| delivery time | 2 weeks |
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(5-aminopentyl)pentanamide (CAS 115416-38-1) is a chemical compound with the molecular formula C15H28N4O2S and a molecular weight of 328.5 g/mol. IUPAC name: 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(5-aminopentyl)pentanamide. InChIKey: CCSGGWGTGOLEHK-OBJOEFQTSA-N.
| Molecular formula | C15H28N4O2S |
|---|---|
| Molecular weight | 328.5 g/mol |
| IUPAC name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(5-aminopentyl)pentanamide |
| InChIKey | CCSGGWGTGOLEHK-OBJOEFQTSA-N |
| SMILES | C1[C@H]2[C@@H]([C@@H](S1)CCCCC(=O)NCCCCCN)NC(=O)N2 |
Computed by PubChem (NCBI)