cas: 1370025-51-6 — see every product listed under this CAS number, including other names
5-(Bromomethyl)-2-(4-(trifluoromethoxy)phenyl)pyridine, 98% (CAS 1370025-51-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A313981-5g |
| cas | 1370025-51-6 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 9548.56 Pln | |
| AmBeed | 10g | 16234.33 Pln | |
| AmBeed | 25g | 31890.88 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-(bromomethyl)-2-[4-(trifluoromethoxy)phenyl]pyridine (CAS 1370025-51-6) is a chemical compound with the molecular formula C13H9BrF3NO and a molecular weight of 332.12 g/mol. IUPAC name: 5-(bromomethyl)-2-[4-(trifluoromethoxy)phenyl]pyridine. InChIKey: GLPCFIVFNJQAJP-UHFFFAOYSA-N.
| Molecular formula | C13H9BrF3NO |
|---|---|
| Molecular weight | 332.12 g/mol |
| IUPAC name | 5-(bromomethyl)-2-[4-(trifluoromethoxy)phenyl]pyridine |
| InChIKey | GLPCFIVFNJQAJP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC=C(C=C2)CBr)OC(F)(F)F |
Computed by PubChem (NCBI)