Products 1215206-00-0
CAS 1215206-00-0 is the registry number for 1-Benzyl-3-bromo-5-(trifluoromethyl)pyridin-2(1H)-one, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 100g, 5g, 25g, 1g.
1-benzyl-3-bromo-5-(trifluoromethyl)pyridin-2-one (CAS 1215206-00-0) is a chemical compound with the molecular formula C13H9BrF3NO and a molecular weight of 332.12 g/mol. IUPAC name: 1-benzyl-3-bromo-5-(trifluoromethyl)pyridin-2-one. InChIKey: FIJNVJVKAFYPBW-UHFFFAOYSA-N.
| Molecular formula | C13H9BrF3NO |
|---|---|
| Molecular weight | 332.12 g/mol |
| IUPAC name | 1-benzyl-3-bromo-5-(trifluoromethyl)pyridin-2-one |
| InChIKey | FIJNVJVKAFYPBW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=C(C=C(C2=O)Br)C(F)(F)F |
Computed by PubChem (NCBI)