cas: 198404-35-2 — see every product listed under this CAS number, including other names
5-(Bromomethyl)-2-(trifluoromethyl)pyrimidine 98% (CAS 198404-35-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A784932-100mg |
| cas | 198404-35-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 209.06 Pln | |
| Ambeed | 250mg | 242.44 Pln | |
| Ambeed | 1g | 670.75 Pln | |
| Ambeed | 5g | 2189.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A784932 |
5-(bromomethyl)-2-(trifluoromethyl)pyrimidine (CAS 198404-35-2) is a chemical compound with the molecular formula C6H4BrF3N2 and a molecular weight of 241.01 g/mol. IUPAC name: 5-(bromomethyl)-2-(trifluoromethyl)pyrimidine. InChIKey: LAZGEURDWNHKNA-UHFFFAOYSA-N.
| Molecular formula | C6H4BrF3N2 |
|---|---|
| Molecular weight | 241.01 g/mol |
| IUPAC name | 5-(bromomethyl)-2-(trifluoromethyl)pyrimidine |
| InChIKey | LAZGEURDWNHKNA-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=N1)C(F)(F)F)CBr |
Computed by PubChem (NCBI)