cas: 97963-62-7 — see every product listed under this CAS number, including other names
5-(Difluoromethoxy)-1H-benzo[d]imidazole-2-thiol, 97%, 97% (CAS 97963-62-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114M8A-5g |
| cas | 97963-62-7 |
| size | 5g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 100g | 122.00 Pln | |
| Chemat | 500g | 403.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-(difluoromethoxy)-1,3-dihydrobenzimidazole-2-thione (CAS 97963-62-7) is a chemical compound with the molecular formula C8H6F2N2OS and a molecular weight of 216.21 g/mol. IUPAC name: 5-(difluoromethoxy)-1,3-dihydrobenzimidazole-2-thione. InChIKey: HJMVPNAZPFZXCP-UHFFFAOYSA-N.
| Molecular formula | C8H6F2N2OS |
|---|---|
| Molecular weight | 216.21 g/mol |
| IUPAC name | 5-(difluoromethoxy)-1,3-dihydrobenzimidazole-2-thione |
| InChIKey | HJMVPNAZPFZXCP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1OC(F)F)NC(=S)N2 |
Computed by PubChem (NCBI)