cas: 97963-62-7 — see every product listed under this CAS number, including other names
5-Difluoromethoxy-2-mercaptobenzimidazole 97% (CAS 97963-62-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A223953-10g |
| cas | 97963-62-7 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 131.19 Pln | |
| Ambeed | 25g | 147.88 Pln | |
| Ambeed | 100g | 214.62 Pln | |
| Ambeed | 500g | 442.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A223953 |
5-(difluoromethoxy)-1,3-dihydrobenzimidazole-2-thione (CAS 97963-62-7) is a chemical compound with the molecular formula C8H6F2N2OS and a molecular weight of 216.21 g/mol. IUPAC name: 5-(difluoromethoxy)-1,3-dihydrobenzimidazole-2-thione. InChIKey: HJMVPNAZPFZXCP-UHFFFAOYSA-N.
| Molecular formula | C8H6F2N2OS |
|---|---|
| Molecular weight | 216.21 g/mol |
| IUPAC name | 5-(difluoromethoxy)-1,3-dihydrobenzimidazole-2-thione |
| InChIKey | HJMVPNAZPFZXCP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1OC(F)F)NC(=S)N2 |
Computed by PubChem (NCBI)