cas: 1150561-58-2 — see every product listed under this CAS number, including other names
5-(Ethoxycarbonyl)-6-methylpyridine-3-boronic acid, pinacol ester, 98%, 98% (CAS 1150561-58-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111FRT-100mg |
| cas | 1150561-58-2 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 294.80 Pln | |
| Chemat | 1g | 501.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxylate (CAS 1150561-58-2) is a chemical compound with the molecular formula C15H22BNO4 and a molecular weight of 291.15 g/mol. IUPAC name: ethyl 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxylate. InChIKey: JKRVLCLHODKBDC-UHFFFAOYSA-N.
| Molecular formula | C15H22BNO4 |
|---|---|
| Molecular weight | 291.15 g/mol |
| IUPAC name | ethyl 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxylate |
| InChIKey | JKRVLCLHODKBDC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(N=C2)C)C(=O)OCC |
Computed by PubChem (NCBI)